C23H27ClO7 — CID 91357771
4-[4-chloro-3-[(4-cyclopropylphenyl)-dihydroxymethyl]phenyl]-6-(hydroxymethyl)cyclohexane-1,2,3,5-tetrol (PubChem CID 91357771) has the molecular formula C23H27ClO7 and a molecular weight of 450.92 g/mol. Its IUPAC name is 4-[4-chloro-3-[(4-cyclopropylphenyl)-dihydroxymethyl]phenyl]-6-(hydroxymethyl)cyclohexane-1,2,3,5-tetrol.
| Compound Name | 4-[4-chloro-3-[(4-cyclopropylphenyl)-dihydroxymethyl]phenyl]-6-(hydroxymethyl)cyclohexane-1,2,3,5-tetrol |
|---|---|
| PubChem CID | 91357771 |
| Molecular Formula | C23H27ClO7 |
| Molecular Weight | 450.92 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | 4-[4-chloro-3-[(4-cyclopropylphenyl)-dihydroxymethyl]phenyl]-6-(hydroxymethyl)cyclohexane-1,2,3,5-tetrol |
| SMILES | OCC1C(O)C(O)C(O)C(c2ccc(Cl)c(C(O)(O)c3ccc(C4CC4)cc3)c2)C1O |
| InChI | InChI=1S/C23H27ClO7/c24-17-8-5-13(18-19(26)15(10-25)20(27)22(29)21(18)28)9-16(17)23(30,31)14-6-3-12(4-7-14)11-1-2-11/h3-9,11,15,18-22,25-31H,1-2,10H2 |
| InChIKey | VAHUSYFZRJQJBI-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 141.61 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.92 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|