About N-[(1S)-6-bromo-3-oxo-1,2-dihydroinden-1-yl]acetamide
N-[(1S)-6-bromo-3-oxo-1,2-dihydroinden-1-yl]acetamide (PubChem CID 91358406) has the molecular formula C11H10BrNO2
and a molecular weight of 268.11 g/mol. Its IUPAC name is N-[(1S)-6-bromo-3-oxo-1,2-dihydroinden-1-yl]acetamide.
Molecular Properties
| Compound Name | N-[(1S)-6-bromo-3-oxo-1,2-dihydroinden-1-yl]acetamide |
| PubChem CID | 91358406 |
| Molecular Formula | C11H10BrNO2 |
| Molecular Weight | 268.11 g/mol |
| Exact Mass | 266.99 |
| IUPAC Name | N-[(1S)-6-bromo-3-oxo-1,2-dihydroinden-1-yl]acetamide |
| SMILES | CC(=O)N[C@H]1CC(=O)c2ccc(Br)cc21 |
| InChI | InChI=1S/C11H10BrNO2/c1-6(14)13-10-5-11(15)8-3-2-7(12)4-9(8)10/h2-4,10H,5H2,1H3,(H,13,14)/t10-/m0/s1 |
| InChIKey | MGBLNGHZDHUTOU-JTQLQIEISA-N |
| XLogP | 2.21 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.11 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(1S)-6-bromo-3-oxo-1,2-dihydroinden-1-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1S)-6-bromo-3-oxo-1,2-dihydroinden-1-yl]acetamide?
The IUPAC name of N-[(1S)-6-bromo-3-oxo-1,2-dihydroinden-1-yl]acetamide (CID 91358406) is N-[(1S)-6-bromo-3-oxo-1,2-dihydroinden-1-yl]acetamide.
What is the SMILES notation for N-[(1S)-6-bromo-3-oxo-1,2-dihydroinden-1-yl]acetamide?
The canonical SMILES for N-[(1S)-6-bromo-3-oxo-1,2-dihydroinden-1-yl]acetamide is CC(=O)N[C@H]1CC(=O)c2ccc(Br)cc21.
What is the InChIKey of N-[(1S)-6-bromo-3-oxo-1,2-dihydroinden-1-yl]acetamide?
The InChIKey is MGBLNGHZDHUTOU-JTQLQIEISA-N. The full InChI is InChI=1S/C11H10BrNO2/c1-6(14)13-10-5-11(15)8-3-2-7(12)4-9(8)10/h2-4,10H,5H2,1H3,(H,13,14)/t10-/m0/s1.
What are the key properties of N-[(1S)-6-bromo-3-oxo-1,2-dihydroinden-1-yl]acetamide?
N-[(1S)-6-bromo-3-oxo-1,2-dihydroinden-1-yl]acetamide has a molecular weight of 268.11 g/mol, XLogP of 2.21, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1S)-6-bromo-3-oxo-1,2-dihydroinden-1-yl]acetamide is sourced from PubChem (CID 91358406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).