About 4-methoxybenzenediazonium;1-methyl-4-oxidoperoxysulfanylbenzene
4-methoxybenzenediazonium;1-methyl-4-oxidoperoxysulfanylbenzene (PubChem CID 91358781) has the molecular formula C14H14N2O4S
and a molecular weight of 306.34 g/mol. Its IUPAC name is 4-methoxybenzenediazonium;1-methyl-4-oxidoperoxysulfanylbenzene.
Molecular Properties
| Compound Name | 4-methoxybenzenediazonium;1-methyl-4-oxidoperoxysulfanylbenzene |
| PubChem CID | 91358781 |
| Molecular Formula | C14H14N2O4S |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 4-methoxybenzenediazonium;1-methyl-4-oxidoperoxysulfanylbenzene |
| SMILES | COc1ccc([N+]#N)cc1.Cc1ccc(SOO[O-])cc1 |
| InChI | InChI=1S/C7H7N2O.C7H8O3S/c1-10-7-4-2-6(9-8)3-5-7;1-6-2-4-7(5-3-6)11-10-9-8/h2-5H,1H3;2-5,8H,1H3/q+1;/p-1 |
| InChIKey | HEHUIEBWCYXUAD-UHFFFAOYSA-M |
| XLogP | 3.41 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxybenzenediazonium;1-methyl-4-oxidoperoxysulfanylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxybenzenediazonium;1-methyl-4-oxidoperoxysulfanylbenzene?
The IUPAC name of 4-methoxybenzenediazonium;1-methyl-4-oxidoperoxysulfanylbenzene (CID 91358781) is 4-methoxybenzenediazonium;1-methyl-4-oxidoperoxysulfanylbenzene.
What is the SMILES notation for 4-methoxybenzenediazonium;1-methyl-4-oxidoperoxysulfanylbenzene?
The canonical SMILES for 4-methoxybenzenediazonium;1-methyl-4-oxidoperoxysulfanylbenzene is COc1ccc([N+]#N)cc1.Cc1ccc(SOO[O-])cc1.
What is the InChIKey of 4-methoxybenzenediazonium;1-methyl-4-oxidoperoxysulfanylbenzene?
The InChIKey is HEHUIEBWCYXUAD-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H7N2O.C7H8O3S/c1-10-7-4-2-6(9-8)3-5-7;1-6-2-4-7(5-3-6)11-10-9-8/h2-5H,1H3;2-5,8H,1H3/q+1;/p-1.
What are the key properties of 4-methoxybenzenediazonium;1-methyl-4-oxidoperoxysulfanylbenzene?
4-methoxybenzenediazonium;1-methyl-4-oxidoperoxysulfanylbenzene has a molecular weight of 306.34 g/mol, XLogP of 3.41, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxybenzenediazonium;1-methyl-4-oxidoperoxysulfanylbenzene is sourced from PubChem (CID 91358781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).