C27H37N7O2 — CID 91358829
N-[4-(cyclohexylcarbamoyl)cyclohexyl]-5-[[2-methyl-5-(methylideneamino)penta-2,4-dienyl]amino]pyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 91358829) has the molecular formula C27H37N7O2 and a molecular weight of 491.64 g/mol. Its IUPAC name is N-[4-(cyclohexylcarbamoyl)cyclohexyl]-5-[[2-methyl-5-(methylideneamino)penta-2,4-dienyl]amino]pyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | N-[4-(cyclohexylcarbamoyl)cyclohexyl]-5-[[2-methyl-5-(methylideneamino)penta-2,4-dienyl]amino]pyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 91358829 |
| Molecular Formula | C27H37N7O2 |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.30 |
| IUPAC Name | N-[4-(cyclohexylcarbamoyl)cyclohexyl]-5-[[2-methyl-5-(methylideneamino)penta-2,4-dienyl]amino]pyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | C=NC=CC=C(C)CNc1ccn2ncc(C(=O)NC3CCC(C(=O)NC4CCCCC4)CC3)c2n1 |
| InChI | InChI=1S/C27H37N7O2/c1-19(7-6-15-28-2)17-29-24-14-16-34-25(33-24)23(18-30-34)27(36)32-22-12-10-20(11-13-22)26(35)31-21-8-4-3-5-9-21/h6-7,14-16,18,20-22H,2-5,8-13,17H2,1H3,(H,29,33)(H,31,35)(H,32,36) |
| InChIKey | VQSWHUJYGZSGNX-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|