C7H10N4O2 — CID 91359251
N'-(2,4-dioxo-1H-pyrimidin-6-yl)-N,N-dimethylmethanimidamide (PubChem CID 91359251) has the molecular formula C7H10N4O2 and a molecular weight of 182.18 g/mol. Its IUPAC name is N'-(2,4-dioxo-1H-pyrimidin-6-yl)-N,N-dimethylmethanimidamide.
| Compound Name | N'-(2,4-dioxo-1H-pyrimidin-6-yl)-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 91359251 |
| Molecular Formula | C7H10N4O2 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | N'-(2,4-dioxo-1H-pyrimidin-6-yl)-N,N-dimethylmethanimidamide |
| SMILES | CN(C)C=Nc1cc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C7H10N4O2/c1-11(2)4-8-5-3-6(12)10-7(13)9-5/h3-4H,1-2H3,(H2,9,10,12,13) |
| InChIKey | DZDLTCUAVNBKLL-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 81.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|