C23H16N4O4S2 — CID 91359390
N-[4-[(7-oxo-6,8-dihydropyrrolo[2,3-g][1,3]benzothiazol-8-yl)methylideneamino]phenyl]sulfonylbenzamide (PubChem CID 91359390) has the molecular formula C23H16N4O4S2 and a molecular weight of 476.54 g/mol. Its IUPAC name is N-[4-[(7-oxo-6,8-dihydropyrrolo[2,3-g][1,3]benzothiazol-8-yl)methylideneamino]phenyl]sulfonylbenzamide.
| Compound Name | N-[4-[(7-oxo-6,8-dihydropyrrolo[2,3-g][1,3]benzothiazol-8-yl)methylideneamino]phenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 91359390 |
| Molecular Formula | C23H16N4O4S2 |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 476.06 |
| IUPAC Name | N-[4-[(7-oxo-6,8-dihydropyrrolo[2,3-g][1,3]benzothiazol-8-yl)methylideneamino]phenyl]sulfonylbenzamide |
| SMILES | O=C(NS(=O)(=O)c1ccc(/N=C/C2C(=O)Nc3ccc4ncsc4c32)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H16N4O4S2/c28-22(14-4-2-1-3-5-14)27-33(30,31)16-8-6-15(7-9-16)24-12-17-20-18(26-23(17)29)10-11-19-21(20)32-13-25-19/h1-13,17H,(H,26,29)(H,27,28)/b24-12+ |
| InChIKey | ZQQYLOBHNSMUHH-WYMPLXKRSA-N |
| XLogP | 3.85 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|