C36H35FN4O3 — CID 91359628
but-3-enyl 7-ethyl-4-[[4-(3-fluorobut-1-en-2-yl)cyclohex-2-en-1-ylidene]amino]-2-oxo-1,5-diphenylpyrido[2,3-d]pyrimidine-6-carboxylate (PubChem CID 91359628) has the molecular formula C36H35FN4O3 and a molecular weight of 590.70 g/mol. Its IUPAC name is but-3-enyl 7-ethyl-4-[[4-(3-fluorobut-1-en-2-yl)cyclohex-2-en-1-ylidene]amino]-2-oxo-1,5-diphenylpyrido[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | but-3-enyl 7-ethyl-4-[[4-(3-fluorobut-1-en-2-yl)cyclohex-2-en-1-ylidene]amino]-2-oxo-1,5-diphenylpyrido[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 91359628 |
| Molecular Formula | C36H35FN4O3 |
| Molecular Weight | 590.70 g/mol |
| Exact Mass | 590.27 |
| IUPAC Name | but-3-enyl 7-ethyl-4-[[4-(3-fluorobut-1-en-2-yl)cyclohex-2-en-1-ylidene]amino]-2-oxo-1,5-diphenylpyrido[2,3-d]pyrimidine-6-carboxylate |
| SMILES | C=CCCOC(=O)c1c(CC)nc2c(c(/N=C3\C=CC(C(=C)C(C)F)CC3)nc(=O)n2-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C36H35FN4O3/c1-5-7-22-44-35(42)31-29(6-2)39-34-32(30(31)26-14-10-8-11-15-26)33(40-36(43)41(34)28-16-12-9-13-17-28)38-27-20-18-25(19-21-27)23(3)24(4)37/h5,8-18,20,24-25H,1,3,6-7,19,21-22H2,2,4H3/b38-27+ |
| InChIKey | PNMNOXYDSUMQDV-ACPRRRJJSA-N |
| XLogP | 7.70 |
| TPSA | 86.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.70 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|