C70H82O4 — CID 91359949
9,10-bis[1-[4-[1-(3,4-dihexoxyphenyl)ethenyl]phenyl]ethenyl]anthracene (PubChem CID 91359949) has the molecular formula C70H82O4 and a molecular weight of 987.42 g/mol. Its IUPAC name is 9,10-bis[1-[4-[1-(3,4-dihexoxyphenyl)ethenyl]phenyl]ethenyl]anthracene.
| Compound Name | 9,10-bis[1-[4-[1-(3,4-dihexoxyphenyl)ethenyl]phenyl]ethenyl]anthracene |
|---|---|
| PubChem CID | 91359949 |
| Molecular Formula | C70H82O4 |
| Molecular Weight | 987.42 g/mol |
| Exact Mass | 986.62 |
| IUPAC Name | 9,10-bis[1-[4-[1-(3,4-dihexoxyphenyl)ethenyl]phenyl]ethenyl]anthracene |
| SMILES | C=C(c1ccc(C(=C)c2c3ccccc3c(C(=C)c3ccc(C(=C)c4ccc(OCCCCCC)c(OCCCCCC)c4)cc3)c3ccccc23)cc1)c1ccc(OCCCCCC)c(OCCCCCC)c1 |
| InChI | InChI=1S/C70H82O4/c1-9-13-17-25-45-71-65-43-41-59(49-67(65)73-47-27-19-15-11-3)51(5)55-33-37-57(38-34-55)53(7)69-61-29-21-23-31-63(61)70(64-32-24-22-30-62(64)69)54(8)58-39-35-56(36-40-58)52(6)60-42-44-66(72-46-26-18-14-10-2)68(50-60)74-48-28-20-16-12-4/h21-24,29-44,49-50H,5-20,25-28,45-48H2,1-4H3 |
| InChIKey | GBWGELRHAJHKDJ-UHFFFAOYSA-N |
| XLogP | 20.08 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 987.42 |
| LogP ≤ 5 | 20.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|