About 4-[4-(2-chlorophenyl)-2,6-dihydropyrrolo[3,4-g]carbazol-8-yl]but-3-en-1-ol
4-[4-(2-chlorophenyl)-2,6-dihydropyrrolo[3,4-g]carbazol-8-yl]but-3-en-1-ol (PubChem CID 91359993) has the molecular formula C24H19ClN2O
and a molecular weight of 386.88 g/mol. Its IUPAC name is 4-[4-(2-chlorophenyl)-2,6-dihydropyrrolo[3,4-g]carbazol-8-yl]but-3-en-1-ol.
Molecular Properties
| Compound Name | 4-[4-(2-chlorophenyl)-2,6-dihydropyrrolo[3,4-g]carbazol-8-yl]but-3-en-1-ol |
| PubChem CID | 91359993 |
| Molecular Formula | C24H19ClN2O |
| Molecular Weight | 386.88 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 4-[4-(2-chlorophenyl)-2,6-dihydropyrrolo[3,4-g]carbazol-8-yl]but-3-en-1-ol |
| SMILES | OCCC=Cc1ccc2c(c1)[nH]c1cc(-c3ccccc3Cl)c3c[nH]cc3c12 |
| InChI | InChI=1S/C24H19ClN2O/c25-21-7-2-1-6-16(21)18-12-23-24(20-14-26-13-19(18)20)17-9-8-15(5-3-4-10-28)11-22(17)27-23/h1-3,5-9,11-14,26-28H,4,10H2 |
| InChIKey | ATOMVWGQPAZXBP-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 51.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.88 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-[4-(2-chlorophenyl)-2,6-dihydropyrrolo[3,4-g]carbazol-8-yl]but-3-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(2-chlorophenyl)-2,6-dihydropyrrolo[3,4-g]carbazol-8-yl]but-3-en-1-ol?
The IUPAC name of 4-[4-(2-chlorophenyl)-2,6-dihydropyrrolo[3,4-g]carbazol-8-yl]but-3-en-1-ol (CID 91359993) is 4-[4-(2-chlorophenyl)-2,6-dihydropyrrolo[3,4-g]carbazol-8-yl]but-3-en-1-ol.
What is the SMILES notation for 4-[4-(2-chlorophenyl)-2,6-dihydropyrrolo[3,4-g]carbazol-8-yl]but-3-en-1-ol?
The canonical SMILES for 4-[4-(2-chlorophenyl)-2,6-dihydropyrrolo[3,4-g]carbazol-8-yl]but-3-en-1-ol is OCCC=Cc1ccc2c(c1)[nH]c1cc(-c3ccccc3Cl)c3c[nH]cc3c12.
What is the InChIKey of 4-[4-(2-chlorophenyl)-2,6-dihydropyrrolo[3,4-g]carbazol-8-yl]but-3-en-1-ol?
The InChIKey is ATOMVWGQPAZXBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19ClN2O/c25-21-7-2-1-6-16(21)18-12-23-24(20-14-26-13-19(18)20)17-9-8-15(5-3-4-10-28)11-22(17)27-23/h1-3,5-9,11-14,26-28H,4,10H2.
What are the key properties of 4-[4-(2-chlorophenyl)-2,6-dihydropyrrolo[3,4-g]carbazol-8-yl]but-3-en-1-ol?
4-[4-(2-chlorophenyl)-2,6-dihydropyrrolo[3,4-g]carbazol-8-yl]but-3-en-1-ol has a molecular weight of 386.88 g/mol, XLogP of 6.52, 4 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(2-chlorophenyl)-2,6-dihydropyrrolo[3,4-g]carbazol-8-yl]but-3-en-1-ol is sourced from PubChem (CID 91359993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).