C8H3Br2F5S — CID 91360120
1,3-dibromo-5-(1,1,2,2,2-pentafluoroethylsulfanyl)benzene (PubChem CID 91360120) has the molecular formula C8H3Br2F5S and a molecular weight of 385.98 g/mol. Its IUPAC name is 1,3-dibromo-5-(1,1,2,2,2-pentafluoroethylsulfanyl)benzene.
| Compound Name | 1,3-dibromo-5-(1,1,2,2,2-pentafluoroethylsulfanyl)benzene |
|---|---|
| PubChem CID | 91360120 |
| Molecular Formula | C8H3Br2F5S |
| Molecular Weight | 385.98 g/mol |
| Exact Mass | 383.82 |
| IUPAC Name | 1,3-dibromo-5-(1,1,2,2,2-pentafluoroethylsulfanyl)benzene |
| SMILES | FC(F)(F)C(F)(F)Sc1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C8H3Br2F5S/c9-4-1-5(10)3-6(2-4)16-8(14,15)7(11,12)13/h1-3H |
| InChIKey | JAAHNPLMBNDRKN-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.98 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|