C16H22O11 — CID 91360129
(4S,5S,6S,7R)-4,5,6-triacetyl-4,5,6,7-tetrahydroxy-7-(hydroxymethyl)nonane-2,3,8-trione (PubChem CID 91360129) has the molecular formula C16H22O11 and a molecular weight of 390.34 g/mol. Its IUPAC name is (4S,5S,6S,7R)-4,5,6-triacetyl-4,5,6,7-tetrahydroxy-7-(hydroxymethyl)nonane-2,3,8-trione.
| Compound Name | (4S,5S,6S,7R)-4,5,6-triacetyl-4,5,6,7-tetrahydroxy-7-(hydroxymethyl)nonane-2,3,8-trione |
|---|---|
| PubChem CID | 91360129 |
| Molecular Formula | C16H22O11 |
| Molecular Weight | 390.34 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | (4S,5S,6S,7R)-4,5,6-triacetyl-4,5,6,7-tetrahydroxy-7-(hydroxymethyl)nonane-2,3,8-trione |
| SMILES | CC(=O)C(=O)[C@@](O)(C(C)=O)[C@](O)(C(C)=O)[C@](O)(C(C)=O)[C@](O)(CO)C(C)=O |
| InChI | InChI=1S/C16H22O11/c1-7(18)12(23)14(25,9(3)20)16(27,11(5)22)15(26,10(4)21)13(24,6-17)8(2)19/h17,24-27H,6H2,1-5H3/t13-,14-,15-,16+/m0/s1 |
| InChIKey | HRYLCRMCPOGATF-YHUYYLMFSA-N |
| XLogP | -3.58 |
| TPSA | 203.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.34 |
| LogP ≤ 5 | -3.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|