C14H14 — CID 91360178
1,2,6,9a-tetrahydroanthracene (PubChem CID 91360178) has the molecular formula C14H14 and a molecular weight of 182.27 g/mol. Its IUPAC name is 1,2,6,9a-tetrahydroanthracene.
| Compound Name | 1,2,6,9a-tetrahydroanthracene |
|---|---|
| PubChem CID | 91360178 |
| Molecular Formula | C14H14 |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 1,2,6,9a-tetrahydroanthracene |
| SMILES | C1=CC2=CC3CCC=CC3=CC2=CC1 |
| InChI | InChI=1S/C14H14/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1/h1,4-6,8-10,13H,2-3,7H2 |
| InChIKey | BKAOTYPVLPIJKQ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |