C25H37NO4S — CID 91360337
10,10,11,11-tetramethyl-7-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1,8-dioxacyclohexadec-4-ene-9,13-dione (PubChem CID 91360337) has the molecular formula C25H37NO4S and a molecular weight of 447.64 g/mol. Its IUPAC name is 10,10,11,11-tetramethyl-7-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1,8-dioxacyclohexadec-4-ene-9,13-dione.
| Compound Name | 10,10,11,11-tetramethyl-7-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1,8-dioxacyclohexadec-4-ene-9,13-dione |
|---|---|
| PubChem CID | 91360337 |
| Molecular Formula | C25H37NO4S |
| Molecular Weight | 447.64 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | 10,10,11,11-tetramethyl-7-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1,8-dioxacyclohexadec-4-ene-9,13-dione |
| SMILES | CC(=Cc1csc(C)n1)C1CC=CCCOCCCC(=O)CC(C)(C)C(C)(C)C(=O)O1 |
| InChI | InChI=1S/C25H37NO4S/c1-18(15-20-17-31-19(2)26-20)22-12-8-7-9-13-29-14-10-11-21(27)16-24(3,4)25(5,6)23(28)30-22/h7-8,15,17,22H,9-14,16H2,1-6H3 |
| InChIKey | FBIZTPAWVAJHLE-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.64 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|