About N-ethyl-2,3,3a,7a-tetrahydro-1-benzothiophen-2-amine
N-ethyl-2,3,3a,7a-tetrahydro-1-benzothiophen-2-amine (PubChem CID 91360374) has the molecular formula C10H15NS
and a molecular weight of 181.30 g/mol. Its IUPAC name is N-ethyl-2,3,3a,7a-tetrahydro-1-benzothiophen-2-amine.
Analyze N-ethyl-2,3,3a,7a-tetrahydro-1-benzothiophen-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2,3,3a,7a-tetrahydro-1-benzothiophen-2-amine?
The IUPAC name of N-ethyl-2,3,3a,7a-tetrahydro-1-benzothiophen-2-amine (CID 91360374) is N-ethyl-2,3,3a,7a-tetrahydro-1-benzothiophen-2-amine.
What is the SMILES notation for N-ethyl-2,3,3a,7a-tetrahydro-1-benzothiophen-2-amine?
The canonical SMILES for N-ethyl-2,3,3a,7a-tetrahydro-1-benzothiophen-2-amine is CCNC1CC2C=CC=CC2S1.
What is the InChIKey of N-ethyl-2,3,3a,7a-tetrahydro-1-benzothiophen-2-amine?
The InChIKey is OOFGKYCVGAIPPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NS/c1-2-11-10-7-8-5-3-4-6-9(8)12-10/h3-6,8-11H,2,7H2,1H3.
What are the key properties of N-ethyl-2,3,3a,7a-tetrahydro-1-benzothiophen-2-amine?
N-ethyl-2,3,3a,7a-tetrahydro-1-benzothiophen-2-amine has a molecular weight of 181.30 g/mol, XLogP of 2.17, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2,3,3a,7a-tetrahydro-1-benzothiophen-2-amine is sourced from PubChem (CID 91360374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).