About (2R)-2-tert-butyl-4,4-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid
(2R)-2-tert-butyl-4,4-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (PubChem CID 91360471) has the molecular formula C14H23F2NO4
and a molecular weight of 307.34 g/mol. Its IUPAC name is (2R)-2-tert-butyl-4,4-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid.
Molecular Properties
| Compound Name | (2R)-2-tert-butyl-4,4-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| PubChem CID | 91360471 |
| Molecular Formula | C14H23F2NO4 |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | (2R)-2-tert-butyl-4,4-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)N1CC(F)(F)C[C@]1(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C14H23F2NO4/c1-11(2,3)14(9(18)19)7-13(15,16)8-17(14)10(20)21-12(4,5)6/h7-8H2,1-6H3,(H,18,19)/t14-/m0/s1 |
| InChIKey | OGBCUHSJYVVTLY-AWEZNQCLSA-N |
| XLogP | 3.13 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-2-tert-butyl-4,4-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-tert-butyl-4,4-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid?
The IUPAC name of (2R)-2-tert-butyl-4,4-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (CID 91360471) is (2R)-2-tert-butyl-4,4-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid.
What is the SMILES notation for (2R)-2-tert-butyl-4,4-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid?
The canonical SMILES for (2R)-2-tert-butyl-4,4-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid is CC(C)(C)OC(=O)N1CC(F)(F)C[C@]1(C(=O)O)C(C)(C)C.
What is the InChIKey of (2R)-2-tert-butyl-4,4-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid?
The InChIKey is OGBCUHSJYVVTLY-AWEZNQCLSA-N. The full InChI is InChI=1S/C14H23F2NO4/c1-11(2,3)14(9(18)19)7-13(15,16)8-17(14)10(20)21-12(4,5)6/h7-8H2,1-6H3,(H,18,19)/t14-/m0/s1.
What are the key properties of (2R)-2-tert-butyl-4,4-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid?
(2R)-2-tert-butyl-4,4-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid has a molecular weight of 307.34 g/mol, XLogP of 3.13, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-tert-butyl-4,4-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid is sourced from PubChem (CID 91360471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).