C16H14N2O4S — CID 9136069
[2-oxo-2-(prop-2-ynylamino)ethyl] 2-(4-methoxyphenyl)-1,3-thiazole-4-carboxylate (PubChem CID 9136069) has the molecular formula C16H14N2O4S and a molecular weight of 330.37 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-ynylamino)ethyl] 2-(4-methoxyphenyl)-1,3-thiazole-4-carboxylate.
| Compound Name | [2-oxo-2-(prop-2-ynylamino)ethyl] 2-(4-methoxyphenyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 9136069 |
| Molecular Formula | C16H14N2O4S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | [2-oxo-2-(prop-2-ynylamino)ethyl] 2-(4-methoxyphenyl)-1,3-thiazole-4-carboxylate |
| SMILES | C#CCNC(=O)COC(=O)c1csc(-c2ccc(OC)cc2)n1 |
| InChI | InChI=1S/C16H14N2O4S/c1-3-8-17-14(19)9-22-16(20)13-10-23-15(18-13)11-4-6-12(21-2)7-5-11/h1,4-7,10H,8-9H2,2H3,(H,17,19) |
| InChIKey | LZYRBLRRWOUOCB-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|