About 1-(2,3-dimethyl-2H-imidazol-1-yl)butan-2-ol;propane
1-(2,3-dimethyl-2H-imidazol-1-yl)butan-2-ol;propane (PubChem CID 91360717) has the molecular formula C12H26N2O
and a molecular weight of 214.35 g/mol. Its IUPAC name is 1-(2,3-dimethyl-2H-imidazol-1-yl)butan-2-ol;propane.
Molecular Properties
| Compound Name | 1-(2,3-dimethyl-2H-imidazol-1-yl)butan-2-ol;propane |
| PubChem CID | 91360717 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | 1-(2,3-dimethyl-2H-imidazol-1-yl)butan-2-ol;propane |
| SMILES | CCC.CCC(O)CN1C=CN(C)C1C |
| InChI | InChI=1S/C9H18N2O.C3H8/c1-4-9(12)7-11-6-5-10(3)8(11)2;1-3-2/h5-6,8-9,12H,4,7H2,1-3H3;3H2,1-2H3 |
| InChIKey | IHIPVOCKRITPFS-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2,3-dimethyl-2H-imidazol-1-yl)butan-2-ol;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3-dimethyl-2H-imidazol-1-yl)butan-2-ol;propane?
The IUPAC name of 1-(2,3-dimethyl-2H-imidazol-1-yl)butan-2-ol;propane (CID 91360717) is 1-(2,3-dimethyl-2H-imidazol-1-yl)butan-2-ol;propane.
What is the SMILES notation for 1-(2,3-dimethyl-2H-imidazol-1-yl)butan-2-ol;propane?
The canonical SMILES for 1-(2,3-dimethyl-2H-imidazol-1-yl)butan-2-ol;propane is CCC.CCC(O)CN1C=CN(C)C1C.
What is the InChIKey of 1-(2,3-dimethyl-2H-imidazol-1-yl)butan-2-ol;propane?
The InChIKey is IHIPVOCKRITPFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O.C3H8/c1-4-9(12)7-11-6-5-10(3)8(11)2;1-3-2/h5-6,8-9,12H,4,7H2,1-3H3;3H2,1-2H3.
What are the key properties of 1-(2,3-dimethyl-2H-imidazol-1-yl)butan-2-ol;propane?
1-(2,3-dimethyl-2H-imidazol-1-yl)butan-2-ol;propane has a molecular weight of 214.35 g/mol, XLogP of 2.24, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-dimethyl-2H-imidazol-1-yl)butan-2-ol;propane is sourced from PubChem (CID 91360717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).