C25H39NO4 — CID 91360795
(3S)-2-[(3S,10S,13S,17S)-17-acetyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]-3-amino-4-oxobutanoic acid (PubChem CID 91360795) has the molecular formula C25H39NO4 and a molecular weight of 417.59 g/mol. Its IUPAC name is (3S)-2-[(3S,10S,13S,17S)-17-acetyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]-3-amino-4-oxobutanoic acid.
| Compound Name | (3S)-2-[(3S,10S,13S,17S)-17-acetyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]-3-amino-4-oxobutanoic acid |
|---|---|
| PubChem CID | 91360795 |
| Molecular Formula | C25H39NO4 |
| Molecular Weight | 417.59 g/mol |
| Exact Mass | 417.29 |
| IUPAC Name | (3S)-2-[(3S,10S,13S,17S)-17-acetyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]-3-amino-4-oxobutanoic acid |
| SMILES | CC(=O)[C@H]1CCC2C3CCC4C[C@@H](C(C(=O)O)[C@H](N)C=O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C25H39NO4/c1-14(28)18-6-7-19-17-5-4-16-12-15(22(23(29)30)21(26)13-27)8-10-24(16,2)20(17)9-11-25(18,19)3/h13,15-22H,4-12,26H2,1-3H3,(H,29,30)/t15-,16?,17?,18+,19?,20?,21+,22?,24-,25+/m0/s1 |
| InChIKey | NFKUEYJBABGLSS-HRBRCCSASA-N |
| XLogP | 4.08 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.59 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|