About N-[2-fluoro-4-(1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl)phenyl]methanesulfonamide
N-[2-fluoro-4-(1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl)phenyl]methanesulfonamide (PubChem CID 91360834) has the molecular formula C14H18FN3O3S
and a molecular weight of 327.38 g/mol. Its IUPAC name is N-[2-fluoro-4-(1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl)phenyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[2-fluoro-4-(1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl)phenyl]methanesulfonamide |
| PubChem CID | 91360834 |
| Molecular Formula | C14H18FN3O3S |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | N-[2-fluoro-4-(1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl)phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(C2=CC3(CCNCC3)ON2)cc1F |
| InChI | InChI=1S/C14H18FN3O3S/c1-22(19,20)18-12-3-2-10(8-11(12)15)13-9-14(21-17-13)4-6-16-7-5-14/h2-3,8-9,16-18H,4-7H2,1H3 |
| InChIKey | ZUMXGKKTKBWCGH-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-fluoro-4-(1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl)phenyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-fluoro-4-(1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl)phenyl]methanesulfonamide?
The IUPAC name of N-[2-fluoro-4-(1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl)phenyl]methanesulfonamide (CID 91360834) is N-[2-fluoro-4-(1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl)phenyl]methanesulfonamide.
What is the SMILES notation for N-[2-fluoro-4-(1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl)phenyl]methanesulfonamide?
The canonical SMILES for N-[2-fluoro-4-(1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl)phenyl]methanesulfonamide is CS(=O)(=O)Nc1ccc(C2=CC3(CCNCC3)ON2)cc1F.
What is the InChIKey of N-[2-fluoro-4-(1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl)phenyl]methanesulfonamide?
The InChIKey is ZUMXGKKTKBWCGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18FN3O3S/c1-22(19,20)18-12-3-2-10(8-11(12)15)13-9-14(21-17-13)4-6-16-7-5-14/h2-3,8-9,16-18H,4-7H2,1H3.
What are the key properties of N-[2-fluoro-4-(1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl)phenyl]methanesulfonamide?
N-[2-fluoro-4-(1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl)phenyl]methanesulfonamide has a molecular weight of 327.38 g/mol, XLogP of 1.20, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-fluoro-4-(1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl)phenyl]methanesulfonamide is sourced from PubChem (CID 91360834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).