About 9-(cyclohexen-1-yl)tetracyclo[6.2.1.13,6.02,7]dodec-4-ene
9-(cyclohexen-1-yl)tetracyclo[6.2.1.13,6.02,7]dodec-4-ene (PubChem CID 91360961) has the molecular formula C18H24
and a molecular weight of 240.39 g/mol. Its IUPAC name is 9-(cyclohexen-1-yl)tetracyclo[6.2.1.13,6.02,7]dodec-4-ene.
Molecular Properties
| Compound Name | 9-(cyclohexen-1-yl)tetracyclo[6.2.1.13,6.02,7]dodec-4-ene |
| PubChem CID | 91360961 |
| Molecular Formula | C18H24 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | 9-(cyclohexen-1-yl)tetracyclo[6.2.1.13,6.02,7]dodec-4-ene |
| SMILES | C1=CC2CC1C1C3CC(C4=CCCCC4)C(C3)C21 |
| InChI | InChI=1S/C18H24/c1-2-4-11(5-3-1)15-9-14-10-16(15)18-13-7-6-12(8-13)17(14)18/h4,6-7,12-18H,1-3,5,8-10H2 |
| InChIKey | FCVMAJSEZDNJNX-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 9-(cyclohexen-1-yl)tetracyclo[6.2.1.13,6.02,7]dodec-4-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(cyclohexen-1-yl)tetracyclo[6.2.1.13,6.02,7]dodec-4-ene?
The IUPAC name of 9-(cyclohexen-1-yl)tetracyclo[6.2.1.13,6.02,7]dodec-4-ene (CID 91360961) is 9-(cyclohexen-1-yl)tetracyclo[6.2.1.13,6.02,7]dodec-4-ene.
What is the SMILES notation for 9-(cyclohexen-1-yl)tetracyclo[6.2.1.13,6.02,7]dodec-4-ene?
The canonical SMILES for 9-(cyclohexen-1-yl)tetracyclo[6.2.1.13,6.02,7]dodec-4-ene is C1=CC2CC1C1C3CC(C4=CCCCC4)C(C3)C21.
What is the InChIKey of 9-(cyclohexen-1-yl)tetracyclo[6.2.1.13,6.02,7]dodec-4-ene?
The InChIKey is FCVMAJSEZDNJNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24/c1-2-4-11(5-3-1)15-9-14-10-16(15)18-13-7-6-12(8-13)17(14)18/h4,6-7,12-18H,1-3,5,8-10H2.
What are the key properties of 9-(cyclohexen-1-yl)tetracyclo[6.2.1.13,6.02,7]dodec-4-ene?
9-(cyclohexen-1-yl)tetracyclo[6.2.1.13,6.02,7]dodec-4-ene has a molecular weight of 240.39 g/mol, XLogP of 4.58, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(cyclohexen-1-yl)tetracyclo[6.2.1.13,6.02,7]dodec-4-ene is sourced from PubChem (CID 91360961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).