C17H26N2 — CID 91361054
2-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3-dihydroisoindole (PubChem CID 91361054) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is 2-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3-dihydroisoindole.
| Compound Name | 2-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3-dihydroisoindole |
|---|---|
| PubChem CID | 91361054 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 2-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3-dihydroisoindole |
| SMILES | CC1(C)CC(N2Cc3ccccc3C2)CC(C)(C)N1 |
| InChI | InChI=1S/C17H26N2/c1-16(2)9-15(10-17(3,4)18-16)19-11-13-7-5-6-8-14(13)12-19/h5-8,15,18H,9-12H2,1-4H3 |
| InChIKey | IAPWZTXQWMQOOX-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |