About 3-hydroxytrideca-1,7-dien-4-yn-6-yl acetate
3-hydroxytrideca-1,7-dien-4-yn-6-yl acetate (PubChem CID 91361428) has the molecular formula C15H22O3
and a molecular weight of 250.34 g/mol. Its IUPAC name is 3-hydroxytrideca-1,7-dien-4-yn-6-yl acetate.
Molecular Properties
| Compound Name | 3-hydroxytrideca-1,7-dien-4-yn-6-yl acetate |
| PubChem CID | 91361428 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 3-hydroxytrideca-1,7-dien-4-yn-6-yl acetate |
| SMILES | C=CC(O)C#CC(C=CCCCCC)OC(C)=O |
| InChI | InChI=1S/C15H22O3/c1-4-6-7-8-9-10-15(18-13(3)16)12-11-14(17)5-2/h5,9-10,14-15,17H,2,4,6-8H2,1,3H3 |
| InChIKey | XQQSULFEUQBCLQ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxytrideca-1,7-dien-4-yn-6-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxytrideca-1,7-dien-4-yn-6-yl acetate?
The IUPAC name of 3-hydroxytrideca-1,7-dien-4-yn-6-yl acetate (CID 91361428) is 3-hydroxytrideca-1,7-dien-4-yn-6-yl acetate.
What is the SMILES notation for 3-hydroxytrideca-1,7-dien-4-yn-6-yl acetate?
The canonical SMILES for 3-hydroxytrideca-1,7-dien-4-yn-6-yl acetate is C=CC(O)C#CC(C=CCCCCC)OC(C)=O.
What is the InChIKey of 3-hydroxytrideca-1,7-dien-4-yn-6-yl acetate?
The InChIKey is XQQSULFEUQBCLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O3/c1-4-6-7-8-9-10-15(18-13(3)16)12-11-14(17)5-2/h5,9-10,14-15,17H,2,4,6-8H2,1,3H3.
What are the key properties of 3-hydroxytrideca-1,7-dien-4-yn-6-yl acetate?
3-hydroxytrideca-1,7-dien-4-yn-6-yl acetate has a molecular weight of 250.34 g/mol, XLogP of 2.60, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxytrideca-1,7-dien-4-yn-6-yl acetate is sourced from PubChem (CID 91361428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).