C43H36F6O4S — CID 91361574
1-[1,1,1,3,3,3-hexafluoro-2-(3-methylphenyl)propan-2-yl]-4-methylbenzene;1-methyl-4-[4-[4-(4-methylphenoxy)phenyl]sulfonylphenoxy]benzene (PubChem CID 91361574) has the molecular formula C43H36F6O4S and a molecular weight of 762.81 g/mol. Its IUPAC name is 1-[1,1,1,3,3,3-hexafluoro-2-(3-methylphenyl)propan-2-yl]-4-methylbenzene;1-methyl-4-[4-[4-(4-methylphenoxy)phenyl]sulfonylphenoxy]benzene.
| Compound Name | 1-[1,1,1,3,3,3-hexafluoro-2-(3-methylphenyl)propan-2-yl]-4-methylbenzene;1-methyl-4-[4-[4-(4-methylphenoxy)phenyl]sulfonylphenoxy]benzene |
|---|---|
| PubChem CID | 91361574 |
| Molecular Formula | C43H36F6O4S |
| Molecular Weight | 762.81 g/mol |
| Exact Mass | 762.22 |
| IUPAC Name | 1-[1,1,1,3,3,3-hexafluoro-2-(3-methylphenyl)propan-2-yl]-4-methylbenzene;1-methyl-4-[4-[4-(4-methylphenoxy)phenyl]sulfonylphenoxy]benzene |
| SMILES | Cc1ccc(C(c2cccc(C)c2)(C(F)(F)F)C(F)(F)F)cc1.Cc1ccc(Oc2ccc(S(=O)(=O)c3ccc(Oc4ccc(C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C26H22O4S.C17H14F6/c1-19-3-7-21(8-4-19)29-23-11-15-25(16-12-23)31(27,28)26-17-13-24(14-18-26)30-22-9-5-20(2)6-10-22;1-11-6-8-13(9-7-11)15(16(18,19)20,17(21,22)23)14-5-3-4-12(2)10-14/h3-18H,1-2H3;3-10H,1-2H3 |
| InChIKey | WCEQAYKMFNFDHL-UHFFFAOYSA-N |
| XLogP | 12.43 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.81 |
| LogP ≤ 5 | 12.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |