C28H30ClF3N8O2 — CID 91361582
4-N-[2-chloro-5-[[4-methoxy-3-(trifluoromethyl)anilino]methyl]phenyl]-6-N-(3-morpholin-4-ylpropyl)pyrimido[5,4-d]pyrimidine-4,6-diamine (PubChem CID 91361582) has the molecular formula C28H30ClF3N8O2 and a molecular weight of 603.05 g/mol. Its IUPAC name is 4-N-[2-chloro-5-[[4-methoxy-3-(trifluoromethyl)anilino]methyl]phenyl]-6-N-(3-morpholin-4-ylpropyl)pyrimido[5,4-d]pyrimidine-4,6-diamine.
| Compound Name | 4-N-[2-chloro-5-[[4-methoxy-3-(trifluoromethyl)anilino]methyl]phenyl]-6-N-(3-morpholin-4-ylpropyl)pyrimido[5,4-d]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 91361582 |
| Molecular Formula | C28H30ClF3N8O2 |
| Molecular Weight | 603.05 g/mol |
| Exact Mass | 602.21 |
| IUPAC Name | 4-N-[2-chloro-5-[[4-methoxy-3-(trifluoromethyl)anilino]methyl]phenyl]-6-N-(3-morpholin-4-ylpropyl)pyrimido[5,4-d]pyrimidine-4,6-diamine |
| SMILES | COc1ccc(NCc2ccc(Cl)c(Nc3ncnc4cnc(NCCCN5CCOCC5)nc34)c2)cc1C(F)(F)F |
| InChI | InChI=1S/C28H30ClF3N8O2/c1-41-24-6-4-19(14-20(24)28(30,31)32)34-15-18-3-5-21(29)22(13-18)38-26-25-23(36-17-37-26)16-35-27(39-25)33-7-2-8-40-9-11-42-12-10-40/h3-6,13-14,16-17,34H,2,7-12,15H2,1H3,(H,33,35,39)(H,36,37,38) |
| InChIKey | ATWQSKHQHMVNAH-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 109.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.05 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|