About dimethyl 4-[(4-fluoro-2,6-dimethylphenyl)iminomethyl]pent-2-enedioate
dimethyl 4-[(4-fluoro-2,6-dimethylphenyl)iminomethyl]pent-2-enedioate (PubChem CID 91361751) has the molecular formula C16H18FNO4
and a molecular weight of 307.32 g/mol. Its IUPAC name is dimethyl 4-[(4-fluoro-2,6-dimethylphenyl)iminomethyl]pent-2-enedioate.
Molecular Properties
| Compound Name | dimethyl 4-[(4-fluoro-2,6-dimethylphenyl)iminomethyl]pent-2-enedioate |
| PubChem CID | 91361751 |
| Molecular Formula | C16H18FNO4 |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | dimethyl 4-[(4-fluoro-2,6-dimethylphenyl)iminomethyl]pent-2-enedioate |
| SMILES | COC(=O)C=CC(/C=N/c1c(C)cc(F)cc1C)C(=O)OC |
| InChI | InChI=1S/C16H18FNO4/c1-10-7-13(17)8-11(2)15(10)18-9-12(16(20)22-4)5-6-14(19)21-3/h5-9,12H,1-4H3/b6-5?,18-9+ |
| InChIKey | SHYSYLCLRCWHKQ-SUXPXGMTSA-N |
| XLogP | 2.66 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 4-[(4-fluoro-2,6-dimethylphenyl)iminomethyl]pent-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 4-[(4-fluoro-2,6-dimethylphenyl)iminomethyl]pent-2-enedioate?
The IUPAC name of dimethyl 4-[(4-fluoro-2,6-dimethylphenyl)iminomethyl]pent-2-enedioate (CID 91361751) is dimethyl 4-[(4-fluoro-2,6-dimethylphenyl)iminomethyl]pent-2-enedioate.
What is the SMILES notation for dimethyl 4-[(4-fluoro-2,6-dimethylphenyl)iminomethyl]pent-2-enedioate?
The canonical SMILES for dimethyl 4-[(4-fluoro-2,6-dimethylphenyl)iminomethyl]pent-2-enedioate is COC(=O)C=CC(/C=N/c1c(C)cc(F)cc1C)C(=O)OC.
What is the InChIKey of dimethyl 4-[(4-fluoro-2,6-dimethylphenyl)iminomethyl]pent-2-enedioate?
The InChIKey is SHYSYLCLRCWHKQ-SUXPXGMTSA-N. The full InChI is InChI=1S/C16H18FNO4/c1-10-7-13(17)8-11(2)15(10)18-9-12(16(20)22-4)5-6-14(19)21-3/h5-9,12H,1-4H3/b6-5?,18-9+.
What are the key properties of dimethyl 4-[(4-fluoro-2,6-dimethylphenyl)iminomethyl]pent-2-enedioate?
dimethyl 4-[(4-fluoro-2,6-dimethylphenyl)iminomethyl]pent-2-enedioate has a molecular weight of 307.32 g/mol, XLogP of 2.66, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 4-[(4-fluoro-2,6-dimethylphenyl)iminomethyl]pent-2-enedioate is sourced from PubChem (CID 91361751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).