About ethane;prop-2-enyl N-(1,3-thiazol-4-yl)carbamate
ethane;prop-2-enyl N-(1,3-thiazol-4-yl)carbamate (PubChem CID 91362137) has the molecular formula C9H14N2O2S
and a molecular weight of 214.29 g/mol. Its IUPAC name is ethane;prop-2-enyl N-(1,3-thiazol-4-yl)carbamate.
Molecular Properties
| Compound Name | ethane;prop-2-enyl N-(1,3-thiazol-4-yl)carbamate |
| PubChem CID | 91362137 |
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | ethane;prop-2-enyl N-(1,3-thiazol-4-yl)carbamate |
| SMILES | C=CCOC(=O)Nc1cscn1.CC |
| InChI | InChI=1S/C7H8N2O2S.C2H6/c1-2-3-11-7(10)9-6-4-12-5-8-6;1-2/h2,4-5H,1,3H2,(H,9,10);1-2H3 |
| InChIKey | NOYIHYSCAQPIAH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;prop-2-enyl N-(1,3-thiazol-4-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;prop-2-enyl N-(1,3-thiazol-4-yl)carbamate?
The IUPAC name of ethane;prop-2-enyl N-(1,3-thiazol-4-yl)carbamate (CID 91362137) is ethane;prop-2-enyl N-(1,3-thiazol-4-yl)carbamate.
What is the SMILES notation for ethane;prop-2-enyl N-(1,3-thiazol-4-yl)carbamate?
The canonical SMILES for ethane;prop-2-enyl N-(1,3-thiazol-4-yl)carbamate is C=CCOC(=O)Nc1cscn1.CC.
What is the InChIKey of ethane;prop-2-enyl N-(1,3-thiazol-4-yl)carbamate?
The InChIKey is NOYIHYSCAQPIAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O2S.C2H6/c1-2-3-11-7(10)9-6-4-12-5-8-6;1-2/h2,4-5H,1,3H2,(H,9,10);1-2H3.
What are the key properties of ethane;prop-2-enyl N-(1,3-thiazol-4-yl)carbamate?
ethane;prop-2-enyl N-(1,3-thiazol-4-yl)carbamate has a molecular weight of 214.29 g/mol, XLogP of 2.90, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;prop-2-enyl N-(1,3-thiazol-4-yl)carbamate is sourced from PubChem (CID 91362137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).