C21H21N3OS2 — CID 9136221
N-(3-cyanothiophen-2-yl)-2-[[(R)-(4-propylphenyl)-thiophen-2-ylmethyl]amino]acetamide (PubChem CID 9136221) has the molecular formula C21H21N3OS2 and a molecular weight of 395.55 g/mol. Its IUPAC name is N-(3-cyanothiophen-2-yl)-2-[[(R)-(4-propylphenyl)-thiophen-2-ylmethyl]amino]acetamide.
| Compound Name | N-(3-cyanothiophen-2-yl)-2-[[(R)-(4-propylphenyl)-thiophen-2-ylmethyl]amino]acetamide |
|---|---|
| PubChem CID | 9136221 |
| Molecular Formula | C21H21N3OS2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | N-(3-cyanothiophen-2-yl)-2-[[(R)-(4-propylphenyl)-thiophen-2-ylmethyl]amino]acetamide |
| SMILES | CCCc1ccc([C@@H](NCC(=O)Nc2sccc2C#N)c2cccs2)cc1 |
| InChI | InChI=1S/C21H21N3OS2/c1-2-4-15-6-8-16(9-7-15)20(18-5-3-11-26-18)23-14-19(25)24-21-17(13-22)10-12-27-21/h3,5-12,20,23H,2,4,14H2,1H3,(H,24,25)/t20-/m1/s1 |
| InChIKey | AFEYPSHKBZSTSX-HXUWFJFHSA-N |
| XLogP | 4.95 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |