About 5-ethylidene-4-methylidene-1,3-oxazol-2-amine
5-ethylidene-4-methylidene-1,3-oxazol-2-amine (PubChem CID 91362274) has the molecular formula C6H8N2O
and a molecular weight of 124.14 g/mol. Its IUPAC name is 5-ethylidene-4-methylidene-1,3-oxazol-2-amine.
Molecular Properties
| Compound Name | 5-ethylidene-4-methylidene-1,3-oxazol-2-amine |
| PubChem CID | 91362274 |
| Molecular Formula | C6H8N2O |
| Molecular Weight | 124.14 g/mol |
| Exact Mass | 124.06 |
| IUPAC Name | 5-ethylidene-4-methylidene-1,3-oxazol-2-amine |
| SMILES | C=c1nc(N)oc1=CC |
| InChI | InChI=1S/C6H8N2O/c1-3-5-4(2)8-6(7)9-5/h3H,2H2,1H3,(H2,7,8) |
| InChIKey | OLNPFKUFLHGJRE-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.14 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-ethylidene-4-methylidene-1,3-oxazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethylidene-4-methylidene-1,3-oxazol-2-amine?
The IUPAC name of 5-ethylidene-4-methylidene-1,3-oxazol-2-amine (CID 91362274) is 5-ethylidene-4-methylidene-1,3-oxazol-2-amine.
What is the SMILES notation for 5-ethylidene-4-methylidene-1,3-oxazol-2-amine?
The canonical SMILES for 5-ethylidene-4-methylidene-1,3-oxazol-2-amine is C=c1nc(N)oc1=CC.
What is the InChIKey of 5-ethylidene-4-methylidene-1,3-oxazol-2-amine?
The InChIKey is OLNPFKUFLHGJRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O/c1-3-5-4(2)8-6(7)9-5/h3H,2H2,1H3,(H2,7,8).
What are the key properties of 5-ethylidene-4-methylidene-1,3-oxazol-2-amine?
5-ethylidene-4-methylidene-1,3-oxazol-2-amine has a molecular weight of 124.14 g/mol, XLogP of -0.53, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethylidene-4-methylidene-1,3-oxazol-2-amine is sourced from PubChem (CID 91362274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).