About 7-methoxy-1,4-dihydroquinazoline
7-methoxy-1,4-dihydroquinazoline (PubChem CID 91363181) has the molecular formula C9H10N2O
and a molecular weight of 162.19 g/mol. Its IUPAC name is 7-methoxy-1,4-dihydroquinazoline.
Molecular Properties
| Compound Name | 7-methoxy-1,4-dihydroquinazoline |
| PubChem CID | 91363181 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 7-methoxy-1,4-dihydroquinazoline |
| SMILES | COc1ccc2c(c1)NC=NC2 |
| InChI | InChI=1S/C9H10N2O/c1-12-8-3-2-7-5-10-6-11-9(7)4-8/h2-4,6H,5H2,1H3,(H,10,11) |
| InChIKey | SRWBIYBWTDMCDY-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-methoxy-1,4-dihydroquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-1,4-dihydroquinazoline?
The IUPAC name of 7-methoxy-1,4-dihydroquinazoline (CID 91363181) is 7-methoxy-1,4-dihydroquinazoline.
What is the SMILES notation for 7-methoxy-1,4-dihydroquinazoline?
The canonical SMILES for 7-methoxy-1,4-dihydroquinazoline is COc1ccc2c(c1)NC=NC2.
What is the InChIKey of 7-methoxy-1,4-dihydroquinazoline?
The InChIKey is SRWBIYBWTDMCDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O/c1-12-8-3-2-7-5-10-6-11-9(7)4-8/h2-4,6H,5H2,1H3,(H,10,11).
What are the key properties of 7-methoxy-1,4-dihydroquinazoline?
7-methoxy-1,4-dihydroquinazoline has a molecular weight of 162.19 g/mol, XLogP of 1.65, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-1,4-dihydroquinazoline is sourced from PubChem (CID 91363181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).