C18H25N2OS+ — CID 9136328
[(2S)-1-(methylamino)-1-oxopropan-2-yl]-[(S)-(4-propylphenyl)-thiophen-2-ylmethyl]azanium (PubChem CID 9136328) has the molecular formula C18H25N2OS+ and a molecular weight of 317.48 g/mol. Its IUPAC name is [(2S)-1-(methylamino)-1-oxopropan-2-yl]-[(S)-(4-propylphenyl)-thiophen-2-ylmethyl]azanium.
| Compound Name | [(2S)-1-(methylamino)-1-oxopropan-2-yl]-[(S)-(4-propylphenyl)-thiophen-2-ylmethyl]azanium |
|---|---|
| PubChem CID | 9136328 |
| Molecular Formula | C18H25N2OS+ |
| Molecular Weight | 317.48 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | [(2S)-1-(methylamino)-1-oxopropan-2-yl]-[(S)-(4-propylphenyl)-thiophen-2-ylmethyl]azanium |
| SMILES | CCCc1ccc([C@H]([NH2+][C@@H](C)C(=O)NC)c2cccs2)cc1 |
| InChI | InChI=1S/C18H24N2OS/c1-4-6-14-8-10-15(11-9-14)17(16-7-5-12-22-16)20-13(2)18(21)19-3/h5,7-13,17,20H,4,6H2,1-3H3,(H,19,21)/p+1/t13-,17-/m0/s1 |
| InChIKey | IYLQSYLKCUEKSF-GUYCJALGSA-O |
| XLogP | 2.49 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.48 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |