C12H14FNO3S — CID 91363334
1-(3-fluorophenyl)sulfonyl-2-methylpyrrolidine-2-carbaldehyde (PubChem CID 91363334) has the molecular formula C12H14FNO3S and a molecular weight of 271.31 g/mol. Its IUPAC name is 1-(3-fluorophenyl)sulfonyl-2-methylpyrrolidine-2-carbaldehyde.
| Compound Name | 1-(3-fluorophenyl)sulfonyl-2-methylpyrrolidine-2-carbaldehyde |
|---|---|
| PubChem CID | 91363334 |
| Molecular Formula | C12H14FNO3S |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 1-(3-fluorophenyl)sulfonyl-2-methylpyrrolidine-2-carbaldehyde |
| SMILES | CC1(C=O)CCCN1S(=O)(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C12H14FNO3S/c1-12(9-15)6-3-7-14(12)18(16,17)11-5-2-4-10(13)8-11/h2,4-5,8-9H,3,6-7H2,1H3 |
| InChIKey | APPJOGCMWQIJEN-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|