C20H17Cl2F3O5 — CID 91363483
methyl 2-[2-[[3,5-dichloro-4-(2,2,2-trifluoroethoxy)phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate (PubChem CID 91363483) has the molecular formula C20H17Cl2F3O5 and a molecular weight of 465.25 g/mol. Its IUPAC name is methyl 2-[2-[[3,5-dichloro-4-(2,2,2-trifluoroethoxy)phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate.
| Compound Name | methyl 2-[2-[[3,5-dichloro-4-(2,2,2-trifluoroethoxy)phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 91363483 |
| Molecular Formula | C20H17Cl2F3O5 |
| Molecular Weight | 465.25 g/mol |
| Exact Mass | 464.04 |
| IUPAC Name | methyl 2-[2-[[3,5-dichloro-4-(2,2,2-trifluoroethoxy)phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate |
| SMILES | COC=C(C(=O)OC)c1ccccc1COc1cc(Cl)c(OCC(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C20H17Cl2F3O5/c1-27-10-15(19(26)28-2)14-6-4-3-5-12(14)9-29-13-7-16(21)18(17(22)8-13)30-11-20(23,24)25/h3-8,10H,9,11H2,1-2H3 |
| InChIKey | YGUBFRVABYXQMH-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.25 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|