C14H10ClN5O — CID 91363811
7-[4-(chloromethyl)-1H-pyrazolo[5,4-b]pyridin-6-yl]-1,2-benzoxazol-3-amine (PubChem CID 91363811) has the molecular formula C14H10ClN5O and a molecular weight of 299.72 g/mol. Its IUPAC name is 7-[4-(chloromethyl)-1H-pyrazolo[5,4-b]pyridin-6-yl]-1,2-benzoxazol-3-amine.
| Compound Name | 7-[4-(chloromethyl)-1H-pyrazolo[5,4-b]pyridin-6-yl]-1,2-benzoxazol-3-amine |
|---|---|
| PubChem CID | 91363811 |
| Molecular Formula | C14H10ClN5O |
| Molecular Weight | 299.72 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 7-[4-(chloromethyl)-1H-pyrazolo[5,4-b]pyridin-6-yl]-1,2-benzoxazol-3-amine |
| SMILES | Nc1noc2c(-c3cc(CCl)c4cn[nH]c4n3)cccc12 |
| InChI | InChI=1S/C14H10ClN5O/c15-5-7-4-11(18-14-10(7)6-17-19-14)8-2-1-3-9-12(8)21-20-13(9)16/h1-4,6H,5H2,(H2,16,20)(H,17,18,19) |
| InChIKey | HVCPWSBGOTZOJX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 93.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.72 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|