C19H41N — CID 91364063
4,6-diethyl-N,4,6-trimethyldodecan-5-amine (PubChem CID 91364063) has the molecular formula C19H41N and a molecular weight of 283.54 g/mol. Its IUPAC name is 4,6-diethyl-N,4,6-trimethyldodecan-5-amine.
| Compound Name | 4,6-diethyl-N,4,6-trimethyldodecan-5-amine |
|---|---|
| PubChem CID | 91364063 |
| Molecular Formula | C19H41N |
| Molecular Weight | 283.54 g/mol |
| Exact Mass | 283.32 |
| IUPAC Name | 4,6-diethyl-N,4,6-trimethyldodecan-5-amine |
| SMILES | CCCCCCC(C)(CC)C(NC)C(C)(CC)CCC |
| InChI | InChI=1S/C19H41N/c1-8-12-13-14-16-19(6,11-4)17(20-7)18(5,10-3)15-9-2/h17,20H,8-16H2,1-7H3 |
| InChIKey | ZBMVGZULIBWUIS-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.54 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|