About 5-ethenyl-2,4-dimethyl-1-(3-methylbutyl)-2,3-dihydropyrrole
5-ethenyl-2,4-dimethyl-1-(3-methylbutyl)-2,3-dihydropyrrole (PubChem CID 91364666) has the molecular formula C13H23N
and a molecular weight of 193.33 g/mol. Its IUPAC name is 5-ethenyl-2,4-dimethyl-1-(3-methylbutyl)-2,3-dihydropyrrole.
Molecular Properties
| Compound Name | 5-ethenyl-2,4-dimethyl-1-(3-methylbutyl)-2,3-dihydropyrrole |
| PubChem CID | 91364666 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | 5-ethenyl-2,4-dimethyl-1-(3-methylbutyl)-2,3-dihydropyrrole |
| SMILES | C=CC1=C(C)CC(C)N1CCC(C)C |
| InChI | InChI=1S/C13H23N/c1-6-13-11(4)9-12(5)14(13)8-7-10(2)3/h6,10,12H,1,7-9H2,2-5H3 |
| InChIKey | BABLKCQLJRSDDH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-ethenyl-2,4-dimethyl-1-(3-methylbutyl)-2,3-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenyl-2,4-dimethyl-1-(3-methylbutyl)-2,3-dihydropyrrole?
The IUPAC name of 5-ethenyl-2,4-dimethyl-1-(3-methylbutyl)-2,3-dihydropyrrole (CID 91364666) is 5-ethenyl-2,4-dimethyl-1-(3-methylbutyl)-2,3-dihydropyrrole.
What is the SMILES notation for 5-ethenyl-2,4-dimethyl-1-(3-methylbutyl)-2,3-dihydropyrrole?
The canonical SMILES for 5-ethenyl-2,4-dimethyl-1-(3-methylbutyl)-2,3-dihydropyrrole is C=CC1=C(C)CC(C)N1CCC(C)C.
What is the InChIKey of 5-ethenyl-2,4-dimethyl-1-(3-methylbutyl)-2,3-dihydropyrrole?
The InChIKey is BABLKCQLJRSDDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N/c1-6-13-11(4)9-12(5)14(13)8-7-10(2)3/h6,10,12H,1,7-9H2,2-5H3.
What are the key properties of 5-ethenyl-2,4-dimethyl-1-(3-methylbutyl)-2,3-dihydropyrrole?
5-ethenyl-2,4-dimethyl-1-(3-methylbutyl)-2,3-dihydropyrrole has a molecular weight of 193.33 g/mol, XLogP of 3.59, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenyl-2,4-dimethyl-1-(3-methylbutyl)-2,3-dihydropyrrole is sourced from PubChem (CID 91364666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).