C40H43N3O12 — CID 91364719
2-(2,2-dimethoxyethyl)isoindole-1,3-dione;bis(2-[(5-methyl-1,3-dioxan-2-yl)methyl]isoindole-1,3-dione) (PubChem CID 91364719) has the molecular formula C40H43N3O12 and a molecular weight of 757.79 g/mol. Its IUPAC name is 2-(2,2-dimethoxyethyl)isoindole-1,3-dione;bis(2-[(5-methyl-1,3-dioxan-2-yl)methyl]isoindole-1,3-dione).
| Compound Name | 2-(2,2-dimethoxyethyl)isoindole-1,3-dione;bis(2-[(5-methyl-1,3-dioxan-2-yl)methyl]isoindole-1,3-dione) |
|---|---|
| PubChem CID | 91364719 |
| Molecular Formula | C40H43N3O12 |
| Molecular Weight | 757.79 g/mol |
| Exact Mass | 757.28 |
| IUPAC Name | 2-(2,2-dimethoxyethyl)isoindole-1,3-dione;bis(2-[(5-methyl-1,3-dioxan-2-yl)methyl]isoindole-1,3-dione) |
| SMILES | CC1COC(CN2C(=O)c3ccccc3C2=O)OC1.CC1COC(CN2C(=O)c3ccccc3C2=O)OC1.COC(CN1C(=O)c2ccccc2C1=O)OC |
| InChI | InChI=1S/2C14H15NO4.C12H13NO4/c2*1-9-7-18-12(19-8-9)6-15-13(16)10-4-2-3-5-11(10)14(15)17;1-16-10(17-2)7-13-11(14)8-5-3-4-6-9(8)12(13)15/h2*2-5,9,12H,6-8H2,1H3;3-6,10H,7H2,1-2H3 |
| InChIKey | ZDYGHIJOBHDFHY-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 167.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.79 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|