C42H44F2N4OSi — CID 91364746
[3-(dibenzylamino)-2,6-difluorophenyl]-[5-pyridin-3-yl-4-tri(propan-2-yl)silyl-1H-pyrrolo[2,3-b]pyridin-3-yl]methanone (PubChem CID 91364746) has the molecular formula C42H44F2N4OSi and a molecular weight of 686.92 g/mol. Its IUPAC name is [3-(dibenzylamino)-2,6-difluorophenyl]-[5-pyridin-3-yl-4-tri(propan-2-yl)silyl-1H-pyrrolo[2,3-b]pyridin-3-yl]methanone.
| Compound Name | [3-(dibenzylamino)-2,6-difluorophenyl]-[5-pyridin-3-yl-4-tri(propan-2-yl)silyl-1H-pyrrolo[2,3-b]pyridin-3-yl]methanone |
|---|---|
| PubChem CID | 91364746 |
| Molecular Formula | C42H44F2N4OSi |
| Molecular Weight | 686.92 g/mol |
| Exact Mass | 686.33 |
| IUPAC Name | [3-(dibenzylamino)-2,6-difluorophenyl]-[5-pyridin-3-yl-4-tri(propan-2-yl)silyl-1H-pyrrolo[2,3-b]pyridin-3-yl]methanone |
| SMILES | CC(C)[Si](c1c(-c2cccnc2)cnc2[nH]cc(C(=O)c3c(F)ccc(N(Cc4ccccc4)Cc4ccccc4)c3F)c12)(C(C)C)C(C)C |
| InChI | InChI=1S/C42H44F2N4OSi/c1-27(2)50(28(3)4,29(5)6)41-33(32-18-13-21-45-22-32)23-46-42-37(41)34(24-47-42)40(49)38-35(43)19-20-36(39(38)44)48(25-30-14-9-7-10-15-30)26-31-16-11-8-12-17-31/h7-24,27-29H,25-26H2,1-6H3,(H,46,47) |
| InChIKey | YPZWLWUKFIUCCX-UHFFFAOYSA-N |
| XLogP | 10.23 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.92 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|