C29H44N4O3 — CID 91364774
N-[5-(benzenecarboximidoyl)-1-methyl-3,6-dihydro-2H-pyridin-4-yl]-4-(3-hydroxypyrrolidine-1-carbonyl)-N,2,3,5,5-pentamethylhexanamide (PubChem CID 91364774) has the molecular formula C29H44N4O3 and a molecular weight of 496.70 g/mol. Its IUPAC name is N-[5-(benzenecarboximidoyl)-1-methyl-3,6-dihydro-2H-pyridin-4-yl]-4-(3-hydroxypyrrolidine-1-carbonyl)-N,2,3,5,5-pentamethylhexanamide.
| Compound Name | N-[5-(benzenecarboximidoyl)-1-methyl-3,6-dihydro-2H-pyridin-4-yl]-4-(3-hydroxypyrrolidine-1-carbonyl)-N,2,3,5,5-pentamethylhexanamide |
|---|---|
| PubChem CID | 91364774 |
| Molecular Formula | C29H44N4O3 |
| Molecular Weight | 496.70 g/mol |
| Exact Mass | 496.34 |
| IUPAC Name | N-[5-(benzenecarboximidoyl)-1-methyl-3,6-dihydro-2H-pyridin-4-yl]-4-(3-hydroxypyrrolidine-1-carbonyl)-N,2,3,5,5-pentamethylhexanamide |
| SMILES | [H]/N=C(/C1=C(N(C)C(=O)C(C)C(C)C(C(=O)N2CCC(O)C2)C(C)(C)C)CCN(C)C1)c1ccccc1 |
| InChI | InChI=1S/C29H44N4O3/c1-19(25(29(3,4)5)28(36)33-16-13-22(34)17-33)20(2)27(35)32(7)24-14-15-31(6)18-23(24)26(30)21-11-9-8-10-12-21/h8-12,19-20,22,25,30,34H,13-18H2,1-7H3/b30-26+ |
| InChIKey | IHWZXDVGRMPRIO-URGPHPNLSA-N |
| XLogP | 3.63 |
| TPSA | 87.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.70 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|