C23H20BrN3O4 — CID 91364777
4-(3-bromo-4,5-dimethoxyphenyl)-2-imino-7-(oxiran-2-ylmethyl)-3,4-dihydropyrano[2,3-e]indole-3-carbonitrile (PubChem CID 91364777) has the molecular formula C23H20BrN3O4 and a molecular weight of 482.33 g/mol. Its IUPAC name is 4-(3-bromo-4,5-dimethoxyphenyl)-2-imino-7-(oxiran-2-ylmethyl)-3,4-dihydropyrano[2,3-e]indole-3-carbonitrile.
| Compound Name | 4-(3-bromo-4,5-dimethoxyphenyl)-2-imino-7-(oxiran-2-ylmethyl)-3,4-dihydropyrano[2,3-e]indole-3-carbonitrile |
|---|---|
| PubChem CID | 91364777 |
| Molecular Formula | C23H20BrN3O4 |
| Molecular Weight | 482.33 g/mol |
| Exact Mass | 481.06 |
| IUPAC Name | 4-(3-bromo-4,5-dimethoxyphenyl)-2-imino-7-(oxiran-2-ylmethyl)-3,4-dihydropyrano[2,3-e]indole-3-carbonitrile |
| SMILES | [H]/N=C1\Oc2c(ccc3c2ccn3CC2CO2)C(c2cc(Br)c(OC)c(OC)c2)C1C#N |
| InChI | InChI=1S/C23H20BrN3O4/c1-28-19-8-12(7-17(24)22(19)29-2)20-15-3-4-18-14(5-6-27(18)10-13-11-30-13)21(15)31-23(26)16(20)9-25/h3-8,13,16,20,26H,10-11H2,1-2H3/b26-23- |
| InChIKey | DFZAUFAMQOAFKO-RWEWTDSWSA-N |
| XLogP | 4.46 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.33 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|