C22H21BrF2N4O3S — CID 91364964
ethyl 2-[4-[[5-bromo-6-(3,4-difluorophenoxy)-3-pyridinyl]sulfanylamino]-4,5,6,7-tetrahydroindazol-1-yl]acetate (PubChem CID 91364964) has the molecular formula C22H21BrF2N4O3S and a molecular weight of 539.40 g/mol. Its IUPAC name is ethyl 2-[4-[[5-bromo-6-(3,4-difluorophenoxy)-3-pyridinyl]sulfanylamino]-4,5,6,7-tetrahydroindazol-1-yl]acetate.
| Compound Name | ethyl 2-[4-[[5-bromo-6-(3,4-difluorophenoxy)-3-pyridinyl]sulfanylamino]-4,5,6,7-tetrahydroindazol-1-yl]acetate |
|---|---|
| PubChem CID | 91364964 |
| Molecular Formula | C22H21BrF2N4O3S |
| Molecular Weight | 539.40 g/mol |
| Exact Mass | 538.05 |
| IUPAC Name | ethyl 2-[4-[[5-bromo-6-(3,4-difluorophenoxy)-3-pyridinyl]sulfanylamino]-4,5,6,7-tetrahydroindazol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1ncc2c1CCCC2NSc1cnc(Oc2ccc(F)c(F)c2)c(Br)c1 |
| InChI | InChI=1S/C22H21BrF2N4O3S/c1-2-31-21(30)12-29-20-5-3-4-19(15(20)11-27-29)28-33-14-9-16(23)22(26-10-14)32-13-6-7-17(24)18(25)8-13/h6-11,19,28H,2-5,12H2,1H3 |
| InChIKey | MORLOXSJMDELAA-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.40 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|