C18H26F6O — CID 91365425
8-(1-bicyclo[2.2.1]heptanyl)-1,1,1-trifluoro-2-(trifluoromethyl)dec-5-en-2-ol (PubChem CID 91365425) has the molecular formula C18H26F6O and a molecular weight of 372.39 g/mol. Its IUPAC name is 8-(1-bicyclo[2.2.1]heptanyl)-1,1,1-trifluoro-2-(trifluoromethyl)dec-5-en-2-ol.
| Compound Name | 8-(1-bicyclo[2.2.1]heptanyl)-1,1,1-trifluoro-2-(trifluoromethyl)dec-5-en-2-ol |
|---|---|
| PubChem CID | 91365425 |
| Molecular Formula | C18H26F6O |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | 8-(1-bicyclo[2.2.1]heptanyl)-1,1,1-trifluoro-2-(trifluoromethyl)dec-5-en-2-ol |
| SMILES | CCC(CC=CCCC(O)(C(F)(F)F)C(F)(F)F)C12CCC(CC1)C2 |
| InChI | InChI=1S/C18H26F6O/c1-2-14(15-10-7-13(12-15)8-11-15)6-4-3-5-9-16(25,17(19,20)21)18(22,23)24/h3-4,13-14,25H,2,5-12H2,1H3 |
| InChIKey | YDCKEEHGILBEOR-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|