C10H15N2+ — CID 91365569
ethane;3-methyl-2H-imidazo[1,2-a]pyridin-4-ium (PubChem CID 91365569) has the molecular formula C10H15N2+ and a molecular weight of 163.24 g/mol. Its IUPAC name is ethane;3-methyl-2H-imidazo[1,2-a]pyridin-4-ium.
| Compound Name | ethane;3-methyl-2H-imidazo[1,2-a]pyridin-4-ium |
|---|---|
| PubChem CID | 91365569 |
| Molecular Formula | C10H15N2+ |
| Molecular Weight | 163.24 g/mol |
| Exact Mass | 163.12 |
| IUPAC Name | ethane;3-methyl-2H-imidazo[1,2-a]pyridin-4-ium |
| SMILES | CC.CC1=[n+]2ccccc2=NC1 |
| InChI | InChI=1S/C8H9N2.C2H6/c1-7-6-9-8-4-2-3-5-10(7)8;1-2/h2-5H,6H2,1H3;1-2H3/q+1; |
| InChIKey | FOGWKHBMIUXPCX-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 18.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.24 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|