C16H20N6O7 — CID 91365690
3-[2,2,3,3,6,6-hexahydroxy-4-methyl-5-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]-3-oxopropanenitrile (PubChem CID 91365690) has the molecular formula C16H20N6O7 and a molecular weight of 408.37 g/mol. Its IUPAC name is 3-[2,2,3,3,6,6-hexahydroxy-4-methyl-5-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]-3-oxopropanenitrile.
| Compound Name | 3-[2,2,3,3,6,6-hexahydroxy-4-methyl-5-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]-3-oxopropanenitrile |
|---|---|
| PubChem CID | 91365690 |
| Molecular Formula | C16H20N6O7 |
| Molecular Weight | 408.37 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 3-[2,2,3,3,6,6-hexahydroxy-4-methyl-5-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]-3-oxopropanenitrile |
| SMILES | CC1C(N(C)c2ncnc3[nH]ccc23)C(O)(O)N(C(=O)CC#N)C(O)(O)C1(O)O |
| InChI | InChI=1S/C16H20N6O7/c1-8-11(21(2)13-9-4-6-18-12(9)19-7-20-13)15(26,27)22(10(23)3-5-17)16(28,29)14(8,24)25/h4,6-8,11,24-29H,3H2,1-2H3,(H,18,19,20) |
| InChIKey | OPWKXKKWFVFNKM-UHFFFAOYSA-N |
| XLogP | -2.89 |
| TPSA | 210.29 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.37 |
| LogP ≤ 5 | -2.89 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|