C17H12ClNO4S — CID 91365786
3-[3-(3-chlorophenyl)prop-2-enoyl]-1,1-dioxo-2,3-dihydro-1λ6,2-benzothiazin-4-one (PubChem CID 91365786) has the molecular formula C17H12ClNO4S and a molecular weight of 361.81 g/mol. Its IUPAC name is 3-[3-(3-chlorophenyl)prop-2-enoyl]-1,1-dioxo-2,3-dihydro-1λ6,2-benzothiazin-4-one.
| Compound Name | 3-[3-(3-chlorophenyl)prop-2-enoyl]-1,1-dioxo-2,3-dihydro-1λ6,2-benzothiazin-4-one |
|---|---|
| PubChem CID | 91365786 |
| Molecular Formula | C17H12ClNO4S |
| Molecular Weight | 361.81 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | 3-[3-(3-chlorophenyl)prop-2-enoyl]-1,1-dioxo-2,3-dihydro-1λ6,2-benzothiazin-4-one |
| SMILES | O=C(C=Cc1cccc(Cl)c1)C1NS(=O)(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H12ClNO4S/c18-12-5-3-4-11(10-12)8-9-14(20)16-17(21)13-6-1-2-7-15(13)24(22,23)19-16/h1-10,16,19H |
| InChIKey | FPWRSLXTVDGJNP-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.81 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|