About 1,3-dimethylimidazol-2-one;ethane
1,3-dimethylimidazol-2-one;ethane (PubChem CID 91365794) has the molecular formula C7H14N2O
and a molecular weight of 142.20 g/mol. Its IUPAC name is 1,3-dimethylimidazol-2-one;ethane.
Molecular Properties
| Compound Name | 1,3-dimethylimidazol-2-one;ethane |
| PubChem CID | 91365794 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | 1,3-dimethylimidazol-2-one;ethane |
| SMILES | CC.Cn1ccn(C)c1=O |
| InChI | InChI=1S/C5H8N2O.C2H6/c1-6-3-4-7(2)5(6)8;1-2/h3-4H,1-2H3;1-2H3 |
| InChIKey | HCPYTFVYTHJVMM-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 26.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,3-dimethylimidazol-2-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethylimidazol-2-one;ethane?
The IUPAC name of 1,3-dimethylimidazol-2-one;ethane (CID 91365794) is 1,3-dimethylimidazol-2-one;ethane.
What is the SMILES notation for 1,3-dimethylimidazol-2-one;ethane?
The canonical SMILES for 1,3-dimethylimidazol-2-one;ethane is CC.Cn1ccn(C)c1=O.
What is the InChIKey of 1,3-dimethylimidazol-2-one;ethane?
The InChIKey is HCPYTFVYTHJVMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O.C2H6/c1-6-3-4-7(2)5(6)8;1-2/h3-4H,1-2H3;1-2H3.
What are the key properties of 1,3-dimethylimidazol-2-one;ethane?
1,3-dimethylimidazol-2-one;ethane has a molecular weight of 142.20 g/mol, XLogP of 0.75, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethylimidazol-2-one;ethane is sourced from PubChem (CID 91365794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).