C27H38N2O10 — CID 91365803
bis(prop-2-enyl) 2-[[[1,4-dioxo-1,4-bis(prop-2-enoxy)butan-2-yl]-propanoylamino]methyl-propanoylamino]butanedioate (PubChem CID 91365803) has the molecular formula C27H38N2O10 and a molecular weight of 550.61 g/mol. Its IUPAC name is bis(prop-2-enyl) 2-[[[1,4-dioxo-1,4-bis(prop-2-enoxy)butan-2-yl]-propanoylamino]methyl-propanoylamino]butanedioate.
| Compound Name | bis(prop-2-enyl) 2-[[[1,4-dioxo-1,4-bis(prop-2-enoxy)butan-2-yl]-propanoylamino]methyl-propanoylamino]butanedioate |
|---|---|
| PubChem CID | 91365803 |
| Molecular Formula | C27H38N2O10 |
| Molecular Weight | 550.61 g/mol |
| Exact Mass | 550.25 |
| IUPAC Name | bis(prop-2-enyl) 2-[[[1,4-dioxo-1,4-bis(prop-2-enoxy)butan-2-yl]-propanoylamino]methyl-propanoylamino]butanedioate |
| SMILES | C=CCOC(=O)CC(C(=O)OCC=C)N(CN(C(=O)CC)C(CC(=O)OCC=C)C(=O)OCC=C)C(=O)CC |
| InChI | InChI=1S/C27H38N2O10/c1-7-13-36-24(32)17-20(26(34)38-15-9-3)28(22(30)11-5)19-29(23(31)12-6)21(27(35)39-16-10-4)18-25(33)37-14-8-2/h7-10,20-21H,1-4,11-19H2,5-6H3 |
| InChIKey | CPMTYAHSTFWXCB-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 145.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.61 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|