C13H8F9NO6S — CID 91365948
(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl) 1,1,2,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethanesulfonate (PubChem CID 91365948) has the molecular formula C13H8F9NO6S and a molecular weight of 477.26 g/mol. Its IUPAC name is (3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl) 1,1,2,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethanesulfonate.
| Compound Name | (3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl) 1,1,2,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethanesulfonate |
|---|---|
| PubChem CID | 91365948 |
| Molecular Formula | C13H8F9NO6S |
| Molecular Weight | 477.26 g/mol |
| Exact Mass | 476.99 |
| IUPAC Name | (3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl) 1,1,2,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethanesulfonate |
| SMILES | O=S(=O)(On1c(O)c2c(c1O)C1C=CC2C1)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H8F9NO6S/c14-10(15,16)11(17,18)28-12(19,20)13(21,22)30(26,27)29-23-8(24)6-4-1-2-5(3-4)7(6)9(23)25/h1-2,4-5,24-25H,3H2 |
| InChIKey | MWZNEQRHYVTIRB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.26 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|