C14H13FN2O5 — CID 91366629
methyl 4-[(3-cyano-4-fluorophenyl)methyl-methoxyamino]-2,4-dioxobutanoate (PubChem CID 91366629) has the molecular formula C14H13FN2O5 and a molecular weight of 308.27 g/mol. Its IUPAC name is methyl 4-[(3-cyano-4-fluorophenyl)methyl-methoxyamino]-2,4-dioxobutanoate.
| Compound Name | methyl 4-[(3-cyano-4-fluorophenyl)methyl-methoxyamino]-2,4-dioxobutanoate |
|---|---|
| PubChem CID | 91366629 |
| Molecular Formula | C14H13FN2O5 |
| Molecular Weight | 308.27 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | methyl 4-[(3-cyano-4-fluorophenyl)methyl-methoxyamino]-2,4-dioxobutanoate |
| SMILES | COC(=O)C(=O)CC(=O)N(Cc1ccc(F)c(C#N)c1)OC |
| InChI | InChI=1S/C14H13FN2O5/c1-21-14(20)12(18)6-13(19)17(22-2)8-9-3-4-11(15)10(5-9)7-16/h3-5H,6,8H2,1-2H3 |
| InChIKey | CFPBNEVPODWIEP-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 96.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.27 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|