C45H92N2 — CID 91367010
1-N-(17,18-dimethylnonadec-10-enyl)-7-methyl-3-(2-methylbutyl)-6-N-(3,3,4-trimethylhexyl)nonane-1,6-diamine (PubChem CID 91367010) has the molecular formula C45H92N2 and a molecular weight of 661.25 g/mol. Its IUPAC name is 1-N-(17,18-dimethylnonadec-10-enyl)-7-methyl-3-(2-methylbutyl)-6-N-(3,3,4-trimethylhexyl)nonane-1,6-diamine.
| Compound Name | 1-N-(17,18-dimethylnonadec-10-enyl)-7-methyl-3-(2-methylbutyl)-6-N-(3,3,4-trimethylhexyl)nonane-1,6-diamine |
|---|---|
| PubChem CID | 91367010 |
| Molecular Formula | C45H92N2 |
| Molecular Weight | 661.25 g/mol |
| Exact Mass | 660.73 |
| IUPAC Name | 1-N-(17,18-dimethylnonadec-10-enyl)-7-methyl-3-(2-methylbutyl)-6-N-(3,3,4-trimethylhexyl)nonane-1,6-diamine |
| SMILES | CCC(C)CC(CCNCCCCCCCCCC=CCCCCCC(C)C(C)C)CCC(NCCC(C)(C)C(C)CC)C(C)CC |
| InChI | InChI=1S/C45H92N2/c1-12-39(6)37-43(30-31-44(40(7)13-2)47-36-33-45(10,11)42(9)14-3)32-35-46-34-28-26-24-22-20-18-16-15-17-19-21-23-25-27-29-41(8)38(4)5/h17,19,38-44,46-47H,12-16,18,20-37H2,1-11H3 |
| InChIKey | NAAMGHKEMCYUGK-UHFFFAOYSA-N |
| XLogP | 14.19 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.25 |
| LogP ≤ 5 | 14.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|