C13H19ClN3O3+ — CID 9136710
(5-chloro-2-methoxyphenyl)methyl-methyl-[2-(methylcarbamoylamino)-2-oxoethyl]azanium (PubChem CID 9136710) has the molecular formula C13H19ClN3O3+ and a molecular weight of 300.77 g/mol. Its IUPAC name is (5-chloro-2-methoxyphenyl)methyl-methyl-[2-(methylcarbamoylamino)-2-oxoethyl]azanium.
| Compound Name | (5-chloro-2-methoxyphenyl)methyl-methyl-[2-(methylcarbamoylamino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 9136710 |
| Molecular Formula | C13H19ClN3O3+ |
| Molecular Weight | 300.77 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | (5-chloro-2-methoxyphenyl)methyl-methyl-[2-(methylcarbamoylamino)-2-oxoethyl]azanium |
| SMILES | CNC(=O)NC(=O)C[NH+](C)Cc1cc(Cl)ccc1OC |
| InChI | InChI=1S/C13H18ClN3O3/c1-15-13(19)16-12(18)8-17(2)7-9-6-10(14)4-5-11(9)20-3/h4-6H,7-8H2,1-3H3,(H2,15,16,18,19)/p+1 |
| InChIKey | PJMZYTFGWNUDCC-UHFFFAOYSA-O |
| XLogP | -0.18 |
| TPSA | 71.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.77 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |